C24H23F3N6 — CID 71004781
2-[6-[(1R)-1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-8-ethylquinoline (PubChem CID 71004781) has the molecular formula C24H23F3N6 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-[6-[(1R)-1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-8-ethylquinoline.
| Compound Name | 2-[6-[(1R)-1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-8-ethylquinoline |
|---|---|
| PubChem CID | 71004781 |
| Molecular Formula | C24H23F3N6 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[6-[(1R)-1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-8-ethylquinoline |
| SMILES | CCc1cccc2ccc(-c3nnc4ccc(C(N5C[C@@H]6C[C@H]5CN6)C(F)(F)F)cn34)nc12 |
| InChI | InChI=1S/C24H23F3N6/c1-2-14-4-3-5-15-6-8-19(29-21(14)15)23-31-30-20-9-7-16(12-33(20)23)22(24(25,26)27)32-13-17-10-18(32)11-28-17/h3-9,12,17-18,22,28H,2,10-11,13H2,1H3/t17-,18-,22?/m0/s1 |
| InChIKey | SCZDQKIPBLGMKU-KJMDXERQSA-N |
| XLogP | 4.16 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |