C23H22F4N6O2 — CID 71004839
2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxyethanol (PubChem CID 71004839) has the molecular formula C23H22F4N6O2 and a molecular weight of 490.46 g/mol. Its IUPAC name is 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxyethanol.
| Compound Name | 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxyethanol |
|---|---|
| PubChem CID | 71004839 |
| Molecular Formula | C23H22F4N6O2 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxyethanol |
| SMILES | N[C@H]1CCN([C@H](c2ccc3nnc(-c4ccc5cc(F)cc(OCCO)c5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C23H22F4N6O2/c24-15-9-13-1-3-17(29-20(13)18(10-15)35-8-7-34)22-31-30-19-4-2-14(11-33(19)22)21(23(25,26)27)32-6-5-16(28)12-32/h1-4,9-11,16,21,34H,5-8,12,28H2/t16-,21+/m0/s1 |
| InChIKey | AAMOGBNQNYGVGZ-HRAATJIYSA-N |
| XLogP | 3.09 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |