C26H29F3N6O — CID 71004890
3-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]-3-methylbutan-1-ol (PubChem CID 71004890) has the molecular formula C26H29F3N6O and a molecular weight of 498.55 g/mol. Its IUPAC name is 3-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]-3-methylbutan-1-ol.
| Compound Name | 3-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 71004890 |
| Molecular Formula | C26H29F3N6O |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 3-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]-3-methylbutan-1-ol |
| SMILES | CC(C)(CCO)c1cccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)nc12 |
| InChI | InChI=1S/C26H29F3N6O/c1-25(2,11-13-36)19-5-3-4-16-6-8-20(31-22(16)19)24-33-32-21-9-7-17(14-35(21)24)23(26(27,28)29)34-12-10-18(30)15-34/h3-9,14,18,23,36H,10-13,15,30H2,1-2H3/t18-,23+/m0/s1 |
| InChIKey | VINQPVQYOHSCIY-FDDCHVKYSA-N |
| XLogP | 4.24 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |