C26H28F3N7O — CID 71004942
N-propan-2-yl-2-[6-[(1R)-2,2,2-trifluoro-1-[(3S)-3-(methylamino)pyrrolidin-1-yl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carboxamide (PubChem CID 71004942) has the molecular formula C26H28F3N7O and a molecular weight of 511.55 g/mol. Its IUPAC name is N-propan-2-yl-2-[6-[(1R)-2,2,2-trifluoro-1-[(3S)-3-(methylamino)pyrrolidin-1-yl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carboxamide.
| Compound Name | N-propan-2-yl-2-[6-[(1R)-2,2,2-trifluoro-1-[(3S)-3-(methylamino)pyrrolidin-1-yl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 71004942 |
| Molecular Formula | C26H28F3N7O |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-propan-2-yl-2-[6-[(1R)-2,2,2-trifluoro-1-[(3S)-3-(methylamino)pyrrolidin-1-yl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carboxamide |
| SMILES | CN[C@H]1CCN([C@H](c2ccc3nnc(-c4ccc5ccc(C(=O)NC(C)C)cc5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C26H28F3N7O/c1-15(2)31-25(37)17-5-4-16-6-8-20(32-21(16)12-17)24-34-33-22-9-7-18(13-36(22)24)23(26(27,28)29)35-11-10-19(14-35)30-3/h4-9,12-13,15,19,23,30H,10-11,14H2,1-3H3,(H,31,37)/t19-,23+/m0/s1 |
| InChIKey | XLULGWVUPBQVOS-WMZHIEFXSA-N |
| XLogP | 3.98 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |