C19H20FN5OS — CID 71006336
2-[[4-ethyl-5-(6-fluoro-3-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide (PubChem CID 71006336) has the molecular formula C19H20FN5OS and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(6-fluoro-3-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(6-fluoro-3-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 71006336 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[4-ethyl-5-(6-fluoro-3-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CSc2nnc(-c3ccc(F)nc3)n2CC)cc1 |
| InChI | InChI=1S/C19H20FN5OS/c1-3-13-5-8-15(9-6-13)22-17(26)12-27-19-24-23-18(25(19)4-2)14-7-10-16(20)21-11-14/h5-11H,3-4,12H2,1-2H3,(H,22,26) |
| InChIKey | AQEUMYXQULSWRY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|