C10H13FNOS+ — CID 7100658
(2S)-2-[(3-fluorophenoxy)methyl]-1,3-thiazolidin-3-ium (PubChem CID 7100658) has the molecular formula C10H13FNOS+ and a molecular weight of 214.28 g/mol. Its IUPAC name is (2S)-2-[(3-fluorophenoxy)methyl]-1,3-thiazolidin-3-ium.
| Compound Name | (2S)-2-[(3-fluorophenoxy)methyl]-1,3-thiazolidin-3-ium |
|---|---|
| PubChem CID | 7100658 |
| Molecular Formula | C10H13FNOS+ |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (2S)-2-[(3-fluorophenoxy)methyl]-1,3-thiazolidin-3-ium |
| SMILES | Fc1cccc(OC[C@H]2[NH2+]CCS2)c1 |
| InChI | InChI=1S/C10H12FNOS/c11-8-2-1-3-9(6-8)13-7-10-12-4-5-14-10/h1-3,6,10,12H,4-5,7H2/p+1/t10-/m0/s1 |
| InChIKey | ZQBBRHDXJIZLDR-JTQLQIEISA-O |
| XLogP | 0.84 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |