C45H36N4 — CID 71007105
10-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-3-yl]-9,9-dimethylacridine (PubChem CID 71007105) has the molecular formula C45H36N4 and a molecular weight of 632.81 g/mol. Its IUPAC name is 10-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-3-yl]-9,9-dimethylacridine.
| Compound Name | 10-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-3-yl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 71007105 |
| Molecular Formula | C45H36N4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 10-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-3-yl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cc(N3c4ccccc4C(C)(C)c4ccccc43)ccc21 |
| InChI | InChI=1S/C45H36N4/c1-44(2)35-25-23-31(43-47-41(29-15-7-5-8-16-29)46-42(48-43)30-17-9-6-10-18-30)27-33(35)34-28-32(24-26-36(34)44)49-39-21-13-11-19-37(39)45(3,4)38-20-12-14-22-40(38)49/h5-28H,1-4H3 |
| InChIKey | SZUYHGCNKPLOHM-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |