C36H28N4 — CID 71007108
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethylacridine (PubChem CID 71007108) has the molecular formula C36H28N4 and a molecular weight of 516.65 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 71007108 |
| Molecular Formula | C36H28N4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c2ccccc21 |
| InChI | InChI=1S/C36H28N4/c1-36(2)29-20-9-11-22-31(29)40(32-23-12-10-21-30(32)36)28-19-13-18-27(24-28)35-38-33(25-14-5-3-6-15-25)37-34(39-35)26-16-7-4-8-17-26/h3-24H,1-2H3 |
| InChIKey | MDOOMMFDDUJAQD-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |