About 3-bromo-10H-phenoxazine
3-bromo-10H-phenoxazine (PubChem CID 71007119) has the molecular formula C12H8BrNO
and a molecular weight of 262.11 g/mol. Its IUPAC name is 3-bromo-10H-phenoxazine.
Molecular Properties
| Compound Name | 3-bromo-10H-phenoxazine |
| PubChem CID | 71007119 |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 3-bromo-10H-phenoxazine |
| SMILES | Brc1ccc2c(c1)Oc1ccccc1N2 |
| InChI | InChI=1S/C12H8BrNO/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H |
| InChIKey | HSXDCQJBXRAVSM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-10H-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-10H-phenoxazine?
The IUPAC name of 3-bromo-10H-phenoxazine (CID 71007119) is 3-bromo-10H-phenoxazine.
What is the SMILES notation for 3-bromo-10H-phenoxazine?
The canonical SMILES for 3-bromo-10H-phenoxazine is Brc1ccc2c(c1)Oc1ccccc1N2.
What is the InChIKey of 3-bromo-10H-phenoxazine?
The InChIKey is HSXDCQJBXRAVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H.
What are the key properties of 3-bromo-10H-phenoxazine?
3-bromo-10H-phenoxazine has a molecular weight of 262.11 g/mol, XLogP of 4.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-10H-phenoxazine is sourced from PubChem (CID 71007119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).