C27H36N6 — CID 71007206
1,4,7-tris[(6-methyl-2-pyridinyl)methyl]-1,4,7-triazonane (PubChem CID 71007206) has the molecular formula C27H36N6 and a molecular weight of 444.63 g/mol. Its IUPAC name is 1,4,7-tris[(6-methyl-2-pyridinyl)methyl]-1,4,7-triazonane.
| Compound Name | 1,4,7-tris[(6-methyl-2-pyridinyl)methyl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 71007206 |
| Molecular Formula | C27H36N6 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 1,4,7-tris[(6-methyl-2-pyridinyl)methyl]-1,4,7-triazonane |
| SMILES | Cc1cccc(CN2CCN(Cc3cccc(C)n3)CCN(Cc3cccc(C)n3)CC2)n1 |
| InChI | InChI=1S/C27H36N6/c1-22-7-4-10-25(28-22)19-31-13-15-32(20-26-11-5-8-23(2)29-26)17-18-33(16-14-31)21-27-12-6-9-24(3)30-27/h4-12H,13-21H2,1-3H3 |
| InChIKey | KRQWXFPJJHSXIG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |