About 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine
2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine (PubChem CID 71007300) has the molecular formula C22H20F2N6
and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine |
| PubChem CID | 71007300 |
| Molecular Formula | C22H20F2N6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine |
| SMILES | Fc1cccc(F)c1-c1ccc2cnc(Nc3cnccc3N3CCCCC3)n2n1 |
| InChI | InChI=1S/C22H20F2N6/c23-16-5-4-6-17(24)21(16)18-8-7-15-13-26-22(30(15)28-18)27-19-14-25-10-9-20(19)29-11-2-1-3-12-29/h4-10,13-14H,1-3,11-12H2,(H,26,27) |
| InChIKey | HBTNSXWZJPWSMF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The IUPAC name of 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine (CID 71007300) is 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine.
What is the SMILES notation for 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The canonical SMILES for 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine is Fc1cccc(F)c1-c1ccc2cnc(Nc3cnccc3N3CCCCC3)n2n1.
What is the InChIKey of 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The InChIKey is HBTNSXWZJPWSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N6/c23-16-5-4-6-17(24)21(16)18-8-7-15-13-26-22(30(15)28-18)27-19-14-25-10-9-20(19)29-11-2-1-3-12-29/h4-10,13-14H,1-3,11-12H2,(H,26,27).
What are the key properties of 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine has a molecular weight of 406.44 g/mol, XLogP of 4.80, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-N-(4-piperidin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine is sourced from PubChem (CID 71007300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).