C17H14F3N3OS2 — CID 71007366
N-[3-(1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]acetamide (PubChem CID 71007366) has the molecular formula C17H14F3N3OS2 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]acetamide |
|---|---|
| PubChem CID | 71007366 |
| Molecular Formula | C17H14F3N3OS2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]acetamide |
| SMILES | CC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCN(C(F)(F)F)C2 |
| InChI | InChI=1S/C17H14F3N3OS2/c1-9(24)21-15-14(16-22-11-4-2-3-5-12(11)25-16)10-6-7-23(17(18,19)20)8-13(10)26-15/h2-5H,6-8H2,1H3,(H,21,24) |
| InChIKey | ITCUYJTZWVEMCM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|