C39H31FN4S — CID 71007486
2-(5a,6,7,9a-tetrahydrodibenzothiophen-4-yl)-9-(4-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,3,5-triazin-2-yl)-6-fluorocarbazole (PubChem CID 71007486) has the molecular formula C39H31FN4S and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-(5a,6,7,9a-tetrahydrodibenzothiophen-4-yl)-9-(4-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,3,5-triazin-2-yl)-6-fluorocarbazole.
| Compound Name | 2-(5a,6,7,9a-tetrahydrodibenzothiophen-4-yl)-9-(4-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,3,5-triazin-2-yl)-6-fluorocarbazole |
|---|---|
| PubChem CID | 71007486 |
| Molecular Formula | C39H31FN4S |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-(5a,6,7,9a-tetrahydrodibenzothiophen-4-yl)-9-(4-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,3,5-triazin-2-yl)-6-fluorocarbazole |
| SMILES | Fc1ccc2c(c1)c1ccc(-c3cccc4c3SC3CCC=CC43)cc1n2-c1nc(C2=CC=CCC2)nc(C2C=CC=CC2)n1 |
| InChI | InChI=1S/C39H31FN4S/c40-27-19-21-33-32(23-27)29-20-18-26(28-15-9-16-31-30-14-7-8-17-35(30)45-36(28)31)22-34(29)44(33)39-42-37(24-10-3-1-4-11-24)41-38(43-39)25-12-5-2-6-13-25/h1-5,7,9-10,12,14-16,18-24,30,35H,6,8,11,13,17H2 |
| InChIKey | QXANSQVOYLYHNL-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|