C24H23NS — CID 71007516
7-(1,6,7,9b-tetrahydrodibenzothiophen-4-yl)-4b,8a,9,9a-tetrahydro-1H-carbazole (PubChem CID 71007516) has the molecular formula C24H23NS and a molecular weight of 357.52 g/mol. Its IUPAC name is 7-(1,6,7,9b-tetrahydrodibenzothiophen-4-yl)-4b,8a,9,9a-tetrahydro-1H-carbazole.
| Compound Name | 7-(1,6,7,9b-tetrahydrodibenzothiophen-4-yl)-4b,8a,9,9a-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 71007516 |
| Molecular Formula | C24H23NS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 7-(1,6,7,9b-tetrahydrodibenzothiophen-4-yl)-4b,8a,9,9a-tetrahydro-1H-carbazole |
| SMILES | C1=CCC2NC3C=C(C4=C5SC6=C(C=CCC6)C5CC=C4)C=CC3C2=C1 |
| InChI | InChI=1S/C24H23NS/c1-3-10-21-17(6-1)18-13-12-15(14-22(18)25-21)16-8-5-9-20-19-7-2-4-11-23(19)26-24(16)20/h1-3,5-8,12-14,18,20-22,25H,4,9-11H2 |
| InChIKey | BLNUWRRYTFRGGY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |