C21H23F3N4O — CID 71007575
1-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]propan-2-ol (PubChem CID 71007575) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]propan-2-ol.
| Compound Name | 1-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 71007575 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]propan-2-ol |
| SMILES | Cc1cnc2c(c1)c1c(n2CC(C)(O)c2ccc(C(F)(F)F)nc2)CCN(C)C1 |
| InChI | InChI=1S/C21H23F3N4O/c1-13-8-15-16-11-27(3)7-6-17(16)28(19(15)26-9-13)12-20(2,29)14-4-5-18(25-10-14)21(22,23)24/h4-5,8-10,29H,6-7,11-12H2,1-3H3 |
| InChIKey | HJIUQNZNWRXTQN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |