C20H22FN3O — CID 71007585
2-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-1-(4-fluorophenyl)ethanol (PubChem CID 71007585) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 71007585 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(4,12-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-8-yl)-1-(4-fluorophenyl)ethanol |
| SMILES | Cc1cnc2c(c1)c1c(n2CC(O)c2ccc(F)cc2)CCN(C)C1 |
| InChI | InChI=1S/C20H22FN3O/c1-13-9-16-17-11-23(2)8-7-18(17)24(20(16)22-10-13)12-19(25)14-3-5-15(21)6-4-14/h3-6,9-10,19,25H,7-8,11-12H2,1-2H3 |
| InChIKey | IBUMUJZNRFMGFX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |