C22H25FN4O — CID 71007607
14-(fluoromethyl)-10-[2-(6-methoxy-3-pyridinyl)ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene (PubChem CID 71007607) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 14-(fluoromethyl)-10-[2-(6-methoxy-3-pyridinyl)ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene.
| Compound Name | 14-(fluoromethyl)-10-[2-(6-methoxy-3-pyridinyl)ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 71007607 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 14-(fluoromethyl)-10-[2-(6-methoxy-3-pyridinyl)ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
| SMILES | COc1ccc(CCn2c3c(c4nc(CF)ccc42)C2CCCN2CC3)cn1 |
| InChI | InChI=1S/C22H25FN4O/c1-28-20-7-4-15(14-24-20)8-12-27-18-9-11-26-10-2-3-17(26)21(18)22-19(27)6-5-16(13-23)25-22/h4-7,14,17H,2-3,8-13H2,1H3 |
| InChIKey | CJPLBSIYAMLSJB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |