C23H27FN4O2 — CID 71007631
1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-2-(4-methoxyphenyl)propan-2-ol (PubChem CID 71007631) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-2-(4-methoxyphenyl)propan-2-ol.
| Compound Name | 1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-2-(4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 71007631 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-2-(4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(C(C)(O)Cn2c3c(c4nc(CF)ncc42)C2CCCN2CC3)cc1 |
| InChI | InChI=1S/C23H27FN4O2/c1-23(29,15-5-7-16(30-2)8-6-15)14-28-18-9-11-27-10-3-4-17(27)21(18)22-19(28)13-25-20(12-24)26-22/h5-8,13,17,29H,3-4,9-12,14H2,1-2H3 |
| InChIKey | AEDNNLLRFJQQTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |