C23H24F3N3 — CID 71007645
14-methyl-10-[2-[4-(trifluoromethyl)phenyl]ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene (PubChem CID 71007645) has the molecular formula C23H24F3N3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 14-methyl-10-[2-[4-(trifluoromethyl)phenyl]ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene.
| Compound Name | 14-methyl-10-[2-[4-(trifluoromethyl)phenyl]ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 71007645 |
| Molecular Formula | C23H24F3N3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 14-methyl-10-[2-[4-(trifluoromethyl)phenyl]ethyl]-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
| SMILES | Cc1ccc2c(n1)c1c(n2CCc2ccc(C(F)(F)F)cc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H24F3N3/c1-15-4-9-20-22(27-15)21-18-3-2-12-28(18)13-11-19(21)29(20)14-10-16-5-7-17(8-6-16)23(24,25)26/h4-9,18H,2-3,10-14H2,1H3 |
| InChIKey | ICQFGZWMFPXMKI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |