C23H25ClFN3O — CID 71007670
1-(15-chloro-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl)-2-(4-fluorophenyl)propan-2-ol (PubChem CID 71007670) has the molecular formula C23H25ClFN3O and a molecular weight of 413.92 g/mol. Its IUPAC name is 1-(15-chloro-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl)-2-(4-fluorophenyl)propan-2-ol.
| Compound Name | 1-(15-chloro-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl)-2-(4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 71007670 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-(15-chloro-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl)-2-(4-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cn1c2c(c3cc(Cl)cnc31)C1CCCCN1CC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25ClFN3O/c1-23(29,15-5-7-17(25)8-6-15)14-28-20-9-11-27-10-3-2-4-19(27)21(20)18-12-16(24)13-26-22(18)28/h5-8,12-13,19,29H,2-4,9-11,14H2,1H3 |
| InChIKey | RKDIFLUOHSZWEK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |