C20H21F2N5O — CID 71007686
2-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-1-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 71007686) has the molecular formula C20H21F2N5O and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-1-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-1-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 71007686 |
| Molecular Formula | C20H21F2N5O |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]-1-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | OC(Cn1c2c(c3nc(CF)ncc31)C1CCCN1CC2)c1ccc(F)cn1 |
| InChI | InChI=1S/C20H21F2N5O/c21-8-18-24-10-16-20(25-18)19-14-2-1-6-26(14)7-5-15(19)27(16)11-17(28)13-4-3-12(22)9-23-13/h3-4,9-10,14,17,28H,1-2,5-8,11H2 |
| InChIKey | URVTUHHEIXUMJK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |