C22H24ClFN4O — CID 71007691
2-(4-chlorophenyl)-1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]propan-2-ol (PubChem CID 71007691) has the molecular formula C22H24ClFN4O and a molecular weight of 414.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]propan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]propan-2-ol |
|---|---|
| PubChem CID | 71007691 |
| Molecular Formula | C22H24ClFN4O |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[14-(fluoromethyl)-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl]propan-2-ol |
| SMILES | CC(O)(Cn1c2c(c3nc(CF)ncc31)C1CCCN1CC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClFN4O/c1-22(29,14-4-6-15(23)7-5-14)13-28-17-8-10-27-9-2-3-16(27)20(17)21-18(28)12-25-19(11-24)26-21/h4-7,12,16,29H,2-3,8-11,13H2,1H3 |
| InChIKey | NPNHPBQTLRFHRN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |