C24H28N4O — CID 71007695
3-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-(6-methyl-3-pyridinyl)propanamide (PubChem CID 71007695) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-(6-methyl-3-pyridinyl)propanamide.
| Compound Name | 3-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-(6-methyl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 71007695 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-(6-methyl-3-pyridinyl)propanamide |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C(N)=O)c2ccc(C)nc2)CCN2CCCC12 |
| InChI | InChI=1S/C24H28N4O/c1-15-5-8-20-18(12-15)23-21-4-3-10-27(21)11-9-22(23)28(20)14-19(24(25)29)17-7-6-16(2)26-13-17/h5-8,12-13,19,21H,3-4,9-11,14H2,1-2H3,(H2,25,29) |
| InChIKey | KJMLKBYMJSLHHA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|