C22H25F2N3O — CID 71007722
1-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol (PubChem CID 71007722) has the molecular formula C22H25F2N3O and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 71007722 |
| Molecular Formula | C22H25F2N3O |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)(O)c2cccnc2)CC(C(F)F)N(C)C1 |
| InChI | InChI=1S/C22H25F2N3O/c1-14-6-7-18-16(9-14)17-12-26(3)20(21(23)24)10-19(17)27(18)13-22(2,28)15-5-4-8-25-11-15/h4-9,11,20-21,28H,10,12-13H2,1-3H3 |
| InChIKey | CHXLBNKIEXMCOM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|