C23H28N4O — CID 71007875
2-(6-methyl-3-pyridinyl)-1-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)propan-2-ol (PubChem CID 71007875) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-1-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)propan-2-ol.
| Compound Name | 2-(6-methyl-3-pyridinyl)-1-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)propan-2-ol |
|---|---|
| PubChem CID | 71007875 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-1-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)propan-2-ol |
| SMILES | Cc1cnc2c(c1)c1c(n2CC(C)(O)c2ccc(C)nc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H28N4O/c1-15-11-18-21-19-5-4-9-26(19)10-8-20(21)27(22(18)25-12-15)14-23(3,28)17-7-6-16(2)24-13-17/h6-7,11-13,19,28H,4-5,8-10,14H2,1-3H3 |
| InChIKey | VKEUQPPVGOUKIL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |