C23H25F3N4 — CID 71007900
15-methyl-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraene (PubChem CID 71007900) has the molecular formula C23H25F3N4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 15-methyl-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraene.
| Compound Name | 15-methyl-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraene |
|---|---|
| PubChem CID | 71007900 |
| Molecular Formula | C23H25F3N4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 15-methyl-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraene |
| SMILES | Cc1cnc2c(n1)c1c(n2CCc2ccc(C(F)(F)F)cc2)CCN2CCCCC12 |
| InChI | InChI=1S/C23H25F3N4/c1-15-14-27-22-21(28-15)20-18-4-2-3-11-29(18)12-10-19(20)30(22)13-9-16-5-7-17(8-6-16)23(24,25)26/h5-8,14,18H,2-4,9-13H2,1H3 |
| InChIKey | AGHPDDPFVONPSI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |