C23H25F3N4O — CID 71007939
1-(14-methyl-6,10,12,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)-2-[4-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 71007939) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-(14-methyl-6,10,12,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)-2-[4-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-(14-methyl-6,10,12,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)-2-[4-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 71007939 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-(14-methyl-6,10,12,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)-2-[4-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | Cc1cnc2c(n1)c1c(n2CC(C)(O)c2ccc(C(F)(F)F)cc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H25F3N4O/c1-14-12-27-21-20(28-14)19-17-4-3-10-29(17)11-9-18(19)30(21)13-22(2,31)15-5-7-16(8-6-15)23(24,25)26/h5-8,12,17,31H,3-4,9-11,13H2,1-2H3 |
| InChIKey | SOFOMXWAFZWVKA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |