C21H22F3N3O — CID 71008018
1-[2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol (PubChem CID 71008018) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-[2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 71008018 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-2-pyridin-3-ylpropan-2-ol |
| SMILES | CN1CCc2c(c3cc(C(F)(F)F)ccc3n2CC(C)(O)c2cccnc2)C1 |
| InChI | InChI=1S/C21H22F3N3O/c1-20(28,15-4-3-8-25-11-15)13-27-18-6-5-14(21(22,23)24)10-16(18)17-12-26(2)9-7-19(17)27/h3-6,8,10-11,28H,7,9,12-13H2,1-2H3 |
| InChIKey | XJMBFKIORPRDHW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|