C23H25F3N4O — CID 71008133
2-(15-methyl-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 71008133) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-(15-methyl-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(15-methyl-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 71008133 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-(15-methyl-7,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1cnc2c(n1)c1c(n2CC(O)c2ccc(C(F)(F)F)cc2)CCN2CCCCC12 |
| InChI | InChI=1S/C23H25F3N4O/c1-14-12-27-22-21(28-14)20-17-4-2-3-10-29(17)11-9-18(20)30(22)13-19(31)15-5-7-16(8-6-15)23(24,25)26/h5-8,12,17,19,31H,2-4,9-11,13H2,1H3 |
| InChIKey | WPKRZZKLMYXAQM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |