C20H36N4Si — CID 71008471
N',N'-dimethyl-N-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-6-yl]ethane-1,2-diamine (PubChem CID 71008471) has the molecular formula C20H36N4Si and a molecular weight of 360.62 g/mol. Its IUPAC name is N',N'-dimethyl-N-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-6-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-6-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71008471 |
| Molecular Formula | C20H36N4Si |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | N',N'-dimethyl-N-[1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-6-yl]ethane-1,2-diamine |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2ccc(NCCN(C)C)nc21 |
| InChI | InChI=1S/C20H36N4Si/c1-15(2)25(16(3)4,17(5)6)24-13-11-18-9-10-19(22-20(18)24)21-12-14-23(7)8/h9-11,13,15-17H,12,14H2,1-8H3,(H,21,22) |
| InChIKey | ZKURJHMFFBXILA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|