C15H25NO2 — CID 71008673
(E)-1-(4-propan-2-ylpiperidin-1-yl)hept-5-ene-1,4-dione (PubChem CID 71008673) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (E)-1-(4-propan-2-ylpiperidin-1-yl)hept-5-ene-1,4-dione.
| Compound Name | (E)-1-(4-propan-2-ylpiperidin-1-yl)hept-5-ene-1,4-dione |
|---|---|
| PubChem CID | 71008673 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (E)-1-(4-propan-2-ylpiperidin-1-yl)hept-5-ene-1,4-dione |
| SMILES | C/C=C/C(=O)CCC(=O)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H25NO2/c1-4-5-14(17)6-7-15(18)16-10-8-13(9-11-16)12(2)3/h4-5,12-13H,6-11H2,1-3H3/b5-4+ |
| InChIKey | QJYHFKBCJTVEII-SNAWJCMRSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|