About 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide
8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide (PubChem CID 71008767) has the molecular formula C13H12ClN5O2
and a molecular weight of 305.73 g/mol. Its IUPAC name is 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide.
Molecular Properties
| Compound Name | 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide |
| PubChem CID | 71008767 |
| Molecular Formula | C13H12ClN5O2 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide |
| SMILES | CN1Cc2c(C(=O)NN)ncn2-c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C13H12ClN5O2/c1-18-5-10-11(12(20)17-15)16-6-19(10)9-3-2-7(14)4-8(9)13(18)21/h2-4,6H,5,15H2,1H3,(H,17,20) |
| InChIKey | YTJCMHKCGBREPM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide?
The IUPAC name of 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide (CID 71008767) is 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide.
What is the SMILES notation for 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide?
The canonical SMILES for 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide is CN1Cc2c(C(=O)NN)ncn2-c2ccc(Cl)cc2C1=O.
What is the InChIKey of 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide?
The InChIKey is YTJCMHKCGBREPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN5O2/c1-18-5-10-11(12(20)17-15)16-6-19(10)9-3-2-7(14)4-8(9)13(18)21/h2-4,6H,5,15H2,1H3,(H,17,20).
What are the key properties of 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide?
8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide has a molecular weight of 305.73 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carbohydrazide is sourced from PubChem (CID 71008767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).