About 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide
2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide (PubChem CID 71009013) has the molecular formula C10H8BrF4NO2
and a molecular weight of 330.08 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide.
Molecular Properties
| Compound Name | 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide |
| PubChem CID | 71009013 |
| Molecular Formula | C10H8BrF4NO2 |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide |
| SMILES | NC(=O)C(c1cc(Br)c(F)cc1F)C(F)(F)CO |
| InChI | InChI=1S/C10H8BrF4NO2/c11-5-1-4(6(12)2-7(5)13)8(9(16)18)10(14,15)3-17/h1-2,8,17H,3H2,(H2,16,18) |
| InChIKey | KLBZCABKLCJLMI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide?
The IUPAC name of 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide (CID 71009013) is 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide.
What is the SMILES notation for 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide?
The canonical SMILES for 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide is NC(=O)C(c1cc(Br)c(F)cc1F)C(F)(F)CO.
What is the InChIKey of 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide?
The InChIKey is KLBZCABKLCJLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF4NO2/c11-5-1-4(6(12)2-7(5)13)8(9(16)18)10(14,15)3-17/h1-2,8,17H,3H2,(H2,16,18).
What are the key properties of 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide?
2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide has a molecular weight of 330.08 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2,4-difluorophenyl)-3,3-difluoro-4-hydroxybutanamide is sourced from PubChem (CID 71009013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).