C20H18F4N2O4S — CID 71009021
(3aS,7aR)-2-(4-fluorophenyl)sulfonyl-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 71009021) has the molecular formula C20H18F4N2O4S and a molecular weight of 458.43 g/mol. Its IUPAC name is (3aS,7aR)-2-(4-fluorophenyl)sulfonyl-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aS,7aR)-2-(4-fluorophenyl)sulfonyl-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71009021 |
| Molecular Formula | C20H18F4N2O4S |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (3aS,7aR)-2-(4-fluorophenyl)sulfonyl-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | O=C1[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@@H]2CCN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F4N2O4S/c21-14-1-7-17(8-2-14)31(28,29)25-11-13-9-10-26(19(27)18(13)12-25)15-3-5-16(6-4-15)30-20(22,23)24/h1-8,13,18H,9-12H2/t13-,18+/m0/s1 |
| InChIKey | WPSQOKLLQVOTBZ-SCLBCKFNSA-N |
| XLogP | 3.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |