About 4-methoxyquinoline;4-methylquinoline
4-methoxyquinoline;4-methylquinoline (PubChem CID 71009048) has the molecular formula C20H18N2O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-methoxyquinoline;4-methylquinoline.
Molecular Properties
| Compound Name | 4-methoxyquinoline;4-methylquinoline |
| PubChem CID | 71009048 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-methoxyquinoline;4-methylquinoline |
| SMILES | COc1ccnc2ccccc12.Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C10H9NO.C10H9N/c1-12-10-6-7-11-9-5-3-2-4-8(9)10;1-8-6-7-11-10-5-3-2-4-9(8)10/h2-7H,1H3;2-7H,1H3 |
| InChIKey | LYGFIEDEEPWGNJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxyquinoline;4-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyquinoline;4-methylquinoline?
The IUPAC name of 4-methoxyquinoline;4-methylquinoline (CID 71009048) is 4-methoxyquinoline;4-methylquinoline.
What is the SMILES notation for 4-methoxyquinoline;4-methylquinoline?
The canonical SMILES for 4-methoxyquinoline;4-methylquinoline is COc1ccnc2ccccc12.Cc1ccnc2ccccc12.
What is the InChIKey of 4-methoxyquinoline;4-methylquinoline?
The InChIKey is LYGFIEDEEPWGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C10H9N/c1-12-10-6-7-11-9-5-3-2-4-8(9)10;1-8-6-7-11-10-5-3-2-4-9(8)10/h2-7H,1H3;2-7H,1H3.
What are the key properties of 4-methoxyquinoline;4-methylquinoline?
4-methoxyquinoline;4-methylquinoline has a molecular weight of 302.38 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyquinoline;4-methylquinoline is sourced from PubChem (CID 71009048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).