C19H25F3N2O4S — CID 71009119
2-(3-methylbutylsulfonyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 71009119) has the molecular formula C19H25F3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-(3-methylbutylsulfonyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | 2-(3-methylbutylsulfonyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71009119 |
| Molecular Formula | C19H25F3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-(3-methylbutylsulfonyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CC(C)CCS(=O)(=O)N1CC2CCN(c3ccc(OC(F)(F)F)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C19H25F3N2O4S/c1-13(2)8-10-29(26,27)23-11-14-7-9-24(18(25)17(14)12-23)15-3-5-16(6-4-15)28-19(20,21)22/h3-6,13-14,17H,7-12H2,1-2H3 |
| InChIKey | TWMYWSDGOVHDKS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |