About (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine
(4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine (PubChem CID 71009219) has the molecular formula C11H10F3N3O3
and a molecular weight of 289.21 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine.
Molecular Properties
| Compound Name | (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine |
| PubChem CID | 71009219 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine |
| SMILES | C[C@]1(c2ccc(F)c([N+](=O)[O-])c2)N=C(N)OCC1(F)F |
| InChI | InChI=1S/C11H10F3N3O3/c1-10(11(13,14)5-20-9(15)16-10)6-2-3-7(12)8(4-6)17(18)19/h2-4H,5H2,1H3,(H2,15,16)/t10-/m1/s1 |
| InChIKey | QFWXMLPSXCKJMH-SNVBAGLBSA-N |
| XLogP | 1.93 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine?
The IUPAC name of (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine (CID 71009219) is (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine.
What is the SMILES notation for (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine?
The canonical SMILES for (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine is C[C@]1(c2ccc(F)c([N+](=O)[O-])c2)N=C(N)OCC1(F)F.
What is the InChIKey of (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine?
The InChIKey is QFWXMLPSXCKJMH-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H10F3N3O3/c1-10(11(13,14)5-20-9(15)16-10)6-2-3-7(12)8(4-6)17(18)19/h2-4H,5H2,1H3,(H2,15,16)/t10-/m1/s1.
What are the key properties of (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine?
(4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine has a molecular weight of 289.21 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5-difluoro-4-(4-fluoro-3-nitrophenyl)-4-methyl-6H-1,3-oxazin-2-amine is sourced from PubChem (CID 71009219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).