C13H16ClNO3 — CID 71009227
[(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamic acid (PubChem CID 71009227) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is [(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamic acid.
| Compound Name | [(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 71009227 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@H](O)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO3/c14-9-3-1-8(2-4-9)11-7-10(16)5-6-12(11)15-13(17)18/h1-4,10-12,15-16H,5-7H2,(H,17,18)/t10-,11-,12+/m0/s1 |
| InChIKey | SSVZEXVCUNKORB-SDDRHHMPSA-N |
| XLogP | 2.60 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |