C22H24F3N5O5 — CID 71009419
methyl 2-[[(1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-b]pyridin-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonyl]amino]-5,5,5-trifluoropentanoate (PubChem CID 71009419) has the molecular formula C22H24F3N5O5 and a molecular weight of 495.46 g/mol. Its IUPAC name is methyl 2-[[(1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-b]pyridin-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonyl]amino]-5,5,5-trifluoropentanoate.
| Compound Name | methyl 2-[[(1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-b]pyridin-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonyl]amino]-5,5,5-trifluoropentanoate |
|---|---|
| PubChem CID | 71009419 |
| Molecular Formula | C22H24F3N5O5 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | methyl 2-[[(1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-b]pyridin-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonyl]amino]-5,5,5-trifluoropentanoate |
| SMILES | COC(=O)C(CCC(F)(F)F)NC(=O)[C@@H]1C[C@H]2C[C@H]2N1C(=O)Cn1nc(C(C)=O)c2cccnc21 |
| InChI | InChI=1S/C22H24F3N5O5/c1-11(31)18-13-4-3-7-26-19(13)29(28-18)10-17(32)30-15-8-12(15)9-16(30)20(33)27-14(21(34)35-2)5-6-22(23,24)25/h3-4,7,12,14-16H,5-6,8-10H2,1-2H3,(H,27,33)/t12-,14?,15-,16+/m1/s1 |
| InChIKey | IUKNGWRRTGLLOL-OHRKKDJYSA-N |
| XLogP | 1.62 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |