About (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate
(3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 71009783) has the molecular formula C21H21NO5S
and a molecular weight of 399.47 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| PubChem CID | 71009783 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | COc1cccc(COC(=O)c2c(-c3ccc(OC)c(OC)c3)csc2N)c1 |
| InChI | InChI=1S/C21H21NO5S/c1-24-15-6-4-5-13(9-15)11-27-21(23)19-16(12-28-20(19)22)14-7-8-17(25-2)18(10-14)26-3/h4-10,12H,11,22H2,1-3H3 |
| InChIKey | KUYKGKWALOSLME-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The IUPAC name of (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (CID 71009783) is (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The canonical SMILES for (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate is COc1cccc(COC(=O)c2c(-c3ccc(OC)c(OC)c3)csc2N)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The InChIKey is KUYKGKWALOSLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5S/c1-24-15-6-4-5-13(9-15)11-27-21(23)19-16(12-28-20(19)22)14-7-8-17(25-2)18(10-14)26-3/h4-10,12H,11,22H2,1-3H3.
What are the key properties of (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
(3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate has a molecular weight of 399.47 g/mol, XLogP of 4.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate is sourced from PubChem (CID 71009783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).