About N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide
N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 71010443) has the molecular formula C12H21NO2S
and a molecular weight of 243.37 g/mol. Its IUPAC name is N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 71010443 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)C1C=CC(C)=CC1 |
| InChI | InChI=1S/C12H21NO2S/c1-4-5-10-13(3)16(14,15)12-8-6-11(2)7-9-12/h6-8,12H,4-5,9-10H2,1-3H3 |
| InChIKey | HPMPSAPLMOAFSB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide (CID 71010443) is N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide is CCCCN(C)S(=O)(=O)C1C=CC(C)=CC1.
What is the InChIKey of N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is HPMPSAPLMOAFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2S/c1-4-5-10-13(3)16(14,15)12-8-6-11(2)7-9-12/h6-8,12H,4-5,9-10H2,1-3H3.
What are the key properties of N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide?
N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 243.37 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,4-dimethylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 71010443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).