C15H28O4Si — CID 71010826
trans-(3R,5R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3,5-dihydroxycyclohexan-1-one (PubChem CID 71010826) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is trans-(3R,5R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3,5-dihydroxycyclohexan-1-one.
| Compound Name | trans-(3R,5R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3,5-dihydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 71010826 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | trans-(3R,5R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3,5-dihydroxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC=C1[C@H](O)CC(=O)C[C@H]1O |
| InChI | InChI=1S/C15H28O4Si/c1-15(2,3)20(4,5)19-8-6-7-12-13(17)9-11(16)10-14(12)18/h7,13-14,17-18H,6,8-10H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | UHOWBJMWHLTREP-ZIAGYGMSSA-N |
| XLogP | 2.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|