C38H28FN5O8 — CID 71010993
[(2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dibenzoyloxy-2-fluorooxolan-2-yl]methyl benzoate (PubChem CID 71010993) has the molecular formula C38H28FN5O8 and a molecular weight of 701.67 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dibenzoyloxy-2-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dibenzoyloxy-2-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71010993 |
| Molecular Formula | C38H28FN5O8 |
| Molecular Weight | 701.67 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dibenzoyloxy-2-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@](F)(COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H28FN5O8/c39-38(21-49-35(46)25-15-7-2-8-16-25)30(51-37(48)27-19-11-4-12-20-27)29(50-36(47)26-17-9-3-10-18-26)34(52-38)44-23-42-28-31(40-22-41-32(28)44)43-33(45)24-13-5-1-6-14-24/h1-20,22-23,29-30,34H,21H2,(H,40,41,43,45)/t29-,30+,34-,38-/m1/s1 |
| InChIKey | FAMRWBHNUROTSY-IZLKNPQXSA-N |
| XLogP | 5.58 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|