About 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide
5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide (PubChem CID 71011241) has the molecular formula C13H14Cl2N6O
and a molecular weight of 341.20 g/mol. Its IUPAC name is 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide |
| PubChem CID | 71011241 |
| Molecular Formula | C13H14Cl2N6O |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide |
| SMILES | CNc1nc(NCc2c(Cl)cccc2Cl)c(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C13H14Cl2N6O/c1-18-13-20-10(11(17)22)9(16)12(21-13)19-5-6-7(14)3-2-4-8(6)15/h2-4H,5,16H2,1H3,(H2,17,22)(H2,18,19,20,21) |
| InChIKey | GJFDKVIHXQQUSF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide?
The IUPAC name of 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide (CID 71011241) is 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide.
What is the SMILES notation for 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide?
The canonical SMILES for 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide is CNc1nc(NCc2c(Cl)cccc2Cl)c(N)c(C(N)=O)n1.
What is the InChIKey of 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide?
The InChIKey is GJFDKVIHXQQUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N6O/c1-18-13-20-10(11(17)22)9(16)12(21-13)19-5-6-7(14)3-2-4-8(6)15/h2-4H,5,16H2,1H3,(H2,17,22)(H2,18,19,20,21).
What are the key properties of 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide?
5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide has a molecular weight of 341.20 g/mol, XLogP of 2.12, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-[(2,6-dichlorophenyl)methylamino]-2-(methylamino)pyrimidine-4-carboxamide is sourced from PubChem (CID 71011241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).