About (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide
(E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide (PubChem CID 71011255) has the molecular formula C26H26F2N2O2
and a molecular weight of 436.50 g/mol. Its IUPAC name is (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide.
Molecular Properties
| Compound Name | (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide |
| PubChem CID | 71011255 |
| Molecular Formula | C26H26F2N2O2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide |
| SMILES | CC/C(=C(\C(=O)Nc1ccc(OCCNC)cc1)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F2N2O2/c1-3-24(18-4-8-20(27)9-5-18)25(19-6-10-21(28)11-7-19)26(31)30-22-12-14-23(15-13-22)32-17-16-29-2/h4-15,29H,3,16-17H2,1-2H3,(H,30,31)/b25-24+ |
| InChIKey | GMPNDFZWIRAHAC-OCOZRVBESA-N |
| XLogP | 5.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide?
The IUPAC name of (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide (CID 71011255) is (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide.
What is the SMILES notation for (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide?
The canonical SMILES for (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide is CC/C(=C(\C(=O)Nc1ccc(OCCNC)cc1)c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide?
The InChIKey is GMPNDFZWIRAHAC-OCOZRVBESA-N. The full InChI is InChI=1S/C26H26F2N2O2/c1-3-24(18-4-8-20(27)9-5-18)25(19-6-10-21(28)11-7-19)26(31)30-22-12-14-23(15-13-22)32-17-16-29-2/h4-15,29H,3,16-17H2,1-2H3,(H,30,31)/b25-24+.
What are the key properties of (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide?
(E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide has a molecular weight of 436.50 g/mol, XLogP of 5.52, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(4-fluorophenyl)-N-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enamide is sourced from PubChem (CID 71011255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).