About 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one
1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one (PubChem CID 71011325) has the molecular formula C18H13F2N3O2
and a molecular weight of 341.32 g/mol. Its IUPAC name is 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one.
Molecular Properties
| Compound Name | 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one |
| PubChem CID | 71011325 |
| Molecular Formula | C18H13F2N3O2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)CC12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H13F2N3O2/c1-10(24)23-18(13-4-2-3-5-15(13)21-17(18)25)9-16(22-23)12-8-11(19)6-7-14(12)20/h2-8H,9H2,1H3,(H,21,25) |
| InChIKey | ZKZPJOVXJVBBRT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one?
The IUPAC name of 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one (CID 71011325) is 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one.
What is the SMILES notation for 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one?
The canonical SMILES for 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one is CC(=O)N1N=C(c2cc(F)ccc2F)CC12C(=O)Nc1ccccc12.
What is the InChIKey of 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one?
The InChIKey is ZKZPJOVXJVBBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N3O2/c1-10(24)23-18(13-4-2-3-5-15(13)21-17(18)25)9-16(22-23)12-8-11(19)6-7-14(12)20/h2-8H,9H2,1H3,(H,21,25).
What are the key properties of 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one?
1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one has a molecular weight of 341.32 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-acetyl-3'-(2,5-difluorophenyl)spiro[1H-indole-3,5'-4H-pyrazole]-2-one is sourced from PubChem (CID 71011325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).