C23H27FO5S — CID 71011332
(Z)-7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 71011332) has the molecular formula C23H27FO5S and a molecular weight of 434.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71011332 |
| Molecular Formula | C23H27FO5S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](O)CC(=O)[C@@H]1CC(F)C(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H27FO5S/c24-17(23(29)21-11-14-7-5-6-9-20(14)30-21)12-16-15(18(25)13-19(16)26)8-3-1-2-4-10-22(27)28/h1,3,5-7,9,11,15-18,23,25,29H,2,4,8,10,12-13H2,(H,27,28)/b3-1-/t15-,16-,17?,18+,23?/m1/s1 |
| InChIKey | NTKMVMTYQVBJLW-YLJAAQMDSA-N |
| XLogP | 4.43 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|