C26H28FN5O4 — CID 71011851
1'-[6-(5-fluoro-2,3,3a,7a-tetrahydroindole-1-carbonyl)-2-methoxy-2,3-dihydropyridin-4-yl]spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one (PubChem CID 71011851) has the molecular formula C26H28FN5O4 and a molecular weight of 493.54 g/mol. Its IUPAC name is 1'-[6-(5-fluoro-2,3,3a,7a-tetrahydroindole-1-carbonyl)-2-methoxy-2,3-dihydropyridin-4-yl]spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one.
| Compound Name | 1'-[6-(5-fluoro-2,3,3a,7a-tetrahydroindole-1-carbonyl)-2-methoxy-2,3-dihydropyridin-4-yl]spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 71011851 |
| Molecular Formula | C26H28FN5O4 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 1'-[6-(5-fluoro-2,3,3a,7a-tetrahydroindole-1-carbonyl)-2-methoxy-2,3-dihydropyridin-4-yl]spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one |
| SMILES | COC1CC(N2CCC3(CC2)OC(=O)Nc2ncccc23)=CC(C(=O)N2CCC3C=C(F)C=CC32)=N1 |
| InChI | InChI=1S/C26H28FN5O4/c1-35-22-15-18(14-20(29-22)24(33)32-10-6-16-13-17(27)4-5-21(16)32)31-11-7-26(8-12-31)19-3-2-9-28-23(19)30-25(34)36-26/h2-5,9,13-14,16,21-22H,6-8,10-12,15H2,1H3,(H,28,30,34) |
| InChIKey | ULKHSUCUIFSLLU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |