C27H34N2O2 — CID 71011998
N-ethyl-3,3-dimethyl-2-oxo-N-[(2R)-3,3,4,4-tetramethyl-1,2-dihydronaphthalen-2-yl]-1H-indole-5-carboxamide (PubChem CID 71011998) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-2-oxo-N-[(2R)-3,3,4,4-tetramethyl-1,2-dihydronaphthalen-2-yl]-1H-indole-5-carboxamide.
| Compound Name | N-ethyl-3,3-dimethyl-2-oxo-N-[(2R)-3,3,4,4-tetramethyl-1,2-dihydronaphthalen-2-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 71011998 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-ethyl-3,3-dimethyl-2-oxo-N-[(2R)-3,3,4,4-tetramethyl-1,2-dihydronaphthalen-2-yl]-1H-indole-5-carboxamide |
| SMILES | CCN(C(=O)c1ccc2c(c1)C(C)(C)C(=O)N2)[C@@H]1Cc2ccccc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C27H34N2O2/c1-8-29(22-16-17-11-9-10-12-19(17)26(4,5)27(22,6)7)23(30)18-13-14-21-20(15-18)25(2,3)24(31)28-21/h9-15,22H,8,16H2,1-7H3,(H,28,31)/t22-/m1/s1 |
| InChIKey | MPEPGSOBIVOLDM-JOCHJYFZSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |