C27H31F5O5 — CID 71012000
[5,5-difluoro-6-hydroxy-6-(trifluoromethyl)spiro[1,3-dioxane-4,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 71012000) has the molecular formula C27H31F5O5 and a molecular weight of 530.53 g/mol. Its IUPAC name is [5,5-difluoro-6-hydroxy-6-(trifluoromethyl)spiro[1,3-dioxane-4,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | [5,5-difluoro-6-hydroxy-6-(trifluoromethyl)spiro[1,3-dioxane-4,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 71012000 |
| Molecular Formula | C27H31F5O5 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [5,5-difluoro-6-hydroxy-6-(trifluoromethyl)spiro[1,3-dioxane-4,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C(OC12CC3CC(C1)C1(OCOC(O)(C(F)(F)F)C1(F)F)C(C3)C2)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C27H31F5O5/c28-25(29)24(35-11-36-26(25,34)27(30,31)32)16-3-12-4-17(24)10-23(8-12,9-16)37-22(33)19-7-15-6-18(19)21-14-2-1-13(5-14)20(15)21/h1-2,12-21,34H,3-11H2 |
| InChIKey | YOLLYVISGRAMJZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|